C26H30F2 — CID 59076916
CID 59076916 (PubChem CID 59076916) has the molecular formula C26H30F2 and a molecular weight of 380.52 g/mol.
| Compound Name | CID 59076916 |
|---|---|
| PubChem CID | 59076916 |
| Molecular Formula | C26H30F2 |
| Molecular Weight | 380.52 g/mol |
| Exact Mass | 380.23 |
| IUPAC Name | — |
| SMILES | C[C]1CCC([C]2CCC(c3ccc(-c4ccc(C)c(F)c4)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C26H30F2/c1-17-3-6-19(7-4-17)20-9-11-21(12-10-20)22-13-14-24(26(28)15-22)23-8-5-18(2)25(27)16-23/h5,8,13-16,19,21H,3-4,6-7,9-12H2,1-2H3 |
| InChIKey | BDUSIDUDAKFGFG-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.52 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |