C27H29F5O — CID 59076872
CID 59076872 (PubChem CID 59076872) has the molecular formula C27H29F5O and a molecular weight of 464.52 g/mol.
| Compound Name | CID 59076872 |
|---|---|
| PubChem CID | 59076872 |
| Molecular Formula | C27H29F5O |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | — |
| SMILES | C[C]1CCC([C]2CCC(c3ccc(C(F)(F)Oc4cc(F)c(C)c(F)c4)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C27H29F5O/c1-16-3-5-18(6-4-16)19-7-9-20(10-8-19)21-11-12-23(26(30)13-21)27(31,32)33-22-14-24(28)17(2)25(29)15-22/h11-15,18,20H,3-10H2,1-2H3 |
| InChIKey | IPLXVSQCWMYVNN-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |