C23H19F2NS — CID 132552752
4-(4-butylphenyl)-2-fluoro-1-(3-fluoro-4-isothiocyanatophenyl)benzene (PubChem CID 132552752) has the molecular formula C23H19F2NS and a molecular weight of 379.48 g/mol. Its IUPAC name is 4-(4-butylphenyl)-2-fluoro-1-(3-fluoro-4-isothiocyanatophenyl)benzene.
| Compound Name | 4-(4-butylphenyl)-2-fluoro-1-(3-fluoro-4-isothiocyanatophenyl)benzene |
|---|---|
| PubChem CID | 132552752 |
| Molecular Formula | C23H19F2NS |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | 4-(4-butylphenyl)-2-fluoro-1-(3-fluoro-4-isothiocyanatophenyl)benzene |
| SMILES | CCCCc1ccc(-c2ccc(-c3ccc(N=C=S)c(F)c3)c(F)c2)cc1 |
| InChI | InChI=1S/C23H19F2NS/c1-2-3-4-16-5-7-17(8-6-16)18-9-11-20(21(24)13-18)19-10-12-23(26-15-27)22(25)14-19/h5-14H,2-4H2,1H3 |
| InChIKey | JUSAHTPLVPLOCR-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|