C27H24FNS — CID 174352535
2-butyl-5-[4-(3-fluoro-4-isothiocyanatophenyl)-3-methylphenyl]-1H-indene (PubChem CID 174352535) has the molecular formula C27H24FNS and a molecular weight of 413.56 g/mol. Its IUPAC name is 2-butyl-5-[4-(3-fluoro-4-isothiocyanatophenyl)-3-methylphenyl]-1H-indene.
| Compound Name | 2-butyl-5-[4-(3-fluoro-4-isothiocyanatophenyl)-3-methylphenyl]-1H-indene |
|---|---|
| PubChem CID | 174352535 |
| Molecular Formula | C27H24FNS |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | 2-butyl-5-[4-(3-fluoro-4-isothiocyanatophenyl)-3-methylphenyl]-1H-indene |
| SMILES | CCCCC1=Cc2cc(-c3ccc(-c4ccc(N=C=S)c(F)c4)c(C)c3)ccc2C1 |
| InChI | InChI=1S/C27H24FNS/c1-3-4-5-19-13-21-6-7-22(15-24(21)14-19)20-8-10-25(18(2)12-20)23-9-11-27(29-17-30)26(28)16-23/h6-12,14-16H,3-5,13H2,1-2H3 |
| InChIKey | XFUXNAWICJLBDX-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|