C28H25F2NS — CID 174351492
6-[4-[2-(3,5-difluoro-4-isothiocyanatophenyl)ethyl]-3-methylphenyl]-2-propyl-1H-indene (PubChem CID 174351492) has the molecular formula C28H25F2NS and a molecular weight of 445.58 g/mol. Its IUPAC name is 6-[4-[2-(3,5-difluoro-4-isothiocyanatophenyl)ethyl]-3-methylphenyl]-2-propyl-1H-indene.
| Compound Name | 6-[4-[2-(3,5-difluoro-4-isothiocyanatophenyl)ethyl]-3-methylphenyl]-2-propyl-1H-indene |
|---|---|
| PubChem CID | 174351492 |
| Molecular Formula | C28H25F2NS |
| Molecular Weight | 445.58 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | 6-[4-[2-(3,5-difluoro-4-isothiocyanatophenyl)ethyl]-3-methylphenyl]-2-propyl-1H-indene |
| SMILES | CCCC1=Cc2ccc(-c3ccc(CCc4cc(F)c(N=C=S)c(F)c4)c(C)c3)cc2C1 |
| InChI | InChI=1S/C28H25F2NS/c1-3-4-19-12-23-9-10-24(16-25(23)13-19)22-8-7-21(18(2)11-22)6-5-20-14-26(29)28(31-17-32)27(30)15-20/h7-12,14-16H,3-6,13H2,1-2H3 |
| InChIKey | MMWXRMNKDNZINA-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.58 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|