C20H15F3 — CID 174351372
2-propyl-6-[2-(3,4,5-trifluorophenyl)ethynyl]-1H-indene (PubChem CID 174351372) has the molecular formula C20H15F3 and a molecular weight of 312.33 g/mol. Its IUPAC name is 2-propyl-6-[2-(3,4,5-trifluorophenyl)ethynyl]-1H-indene.
| Compound Name | 2-propyl-6-[2-(3,4,5-trifluorophenyl)ethynyl]-1H-indene |
|---|---|
| PubChem CID | 174351372 |
| Molecular Formula | C20H15F3 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 2-propyl-6-[2-(3,4,5-trifluorophenyl)ethynyl]-1H-indene |
| SMILES | CCCC1=Cc2ccc(C#Cc3cc(F)c(F)c(F)c3)cc2C1 |
| InChI | InChI=1S/C20H15F3/c1-2-3-14-9-16-7-6-13(8-17(16)10-14)4-5-15-11-18(21)20(23)19(22)12-15/h6-9,11-12H,2-3,10H2,1H3 |
| InChIKey | UQTRLLJAIBGEQS-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|