About 2-propyl-6-[2-(3,4,5-trifluorophenyl)ethynyl]-1H-indene
2-propyl-6-[2-(3,4,5-trifluorophenyl)ethynyl]-1H-indene (PubChem CID 174351372) has the molecular formula C20H15F3
and a molecular weight of 312.33 g/mol. Its IUPAC name is 2-propyl-6-[2-(3,4,5-trifluorophenyl)ethynyl]-1H-indene.
Molecular Properties
| Compound Name | 2-propyl-6-[2-(3,4,5-trifluorophenyl)ethynyl]-1H-indene |
| PubChem CID | 174351372 |
| Molecular Formula | C20H15F3 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 2-propyl-6-[2-(3,4,5-trifluorophenyl)ethynyl]-1H-indene |
| SMILES | CCCC1=Cc2ccc(C#Cc3cc(F)c(F)c(F)c3)cc2C1 |
| InChI | InChI=1S/C20H15F3/c1-2-3-14-9-16-7-6-13(8-17(16)10-14)4-5-15-11-18(21)20(23)19(22)12-15/h6-9,11-12H,2-3,10H2,1H3 |
| InChIKey | UQTRLLJAIBGEQS-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-propyl-6-[2-(3,4,5-trifluorophenyl)ethynyl]-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propyl-6-[2-(3,4,5-trifluorophenyl)ethynyl]-1H-indene?
The IUPAC name of 2-propyl-6-[2-(3,4,5-trifluorophenyl)ethynyl]-1H-indene (CID 174351372) is 2-propyl-6-[2-(3,4,5-trifluorophenyl)ethynyl]-1H-indene.
What is the SMILES notation for 2-propyl-6-[2-(3,4,5-trifluorophenyl)ethynyl]-1H-indene?
The canonical SMILES for 2-propyl-6-[2-(3,4,5-trifluorophenyl)ethynyl]-1H-indene is CCCC1=Cc2ccc(C#Cc3cc(F)c(F)c(F)c3)cc2C1.
What is the InChIKey of 2-propyl-6-[2-(3,4,5-trifluorophenyl)ethynyl]-1H-indene?
The InChIKey is UQTRLLJAIBGEQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15F3/c1-2-3-14-9-16-7-6-13(8-17(16)10-14)4-5-15-11-18(21)20(23)19(22)12-15/h6-9,11-12H,2-3,10H2,1H3.
What are the key properties of 2-propyl-6-[2-(3,4,5-trifluorophenyl)ethynyl]-1H-indene?
2-propyl-6-[2-(3,4,5-trifluorophenyl)ethynyl]-1H-indene has a molecular weight of 312.33 g/mol, XLogP of 5.24, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propyl-6-[2-(3,4,5-trifluorophenyl)ethynyl]-1H-indene is sourced from PubChem (CID 174351372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).