C22H18F4O — CID 139961380
6-fluoro-3-propyl-7-[2-[4-(trifluoromethoxy)phenyl]ethynyl]-1,2-dihydronaphthalene (PubChem CID 139961380) has the molecular formula C22H18F4O and a molecular weight of 374.38 g/mol. Its IUPAC name is 6-fluoro-3-propyl-7-[2-[4-(trifluoromethoxy)phenyl]ethynyl]-1,2-dihydronaphthalene.
| Compound Name | 6-fluoro-3-propyl-7-[2-[4-(trifluoromethoxy)phenyl]ethynyl]-1,2-dihydronaphthalene |
|---|---|
| PubChem CID | 139961380 |
| Molecular Formula | C22H18F4O |
| Molecular Weight | 374.38 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 6-fluoro-3-propyl-7-[2-[4-(trifluoromethoxy)phenyl]ethynyl]-1,2-dihydronaphthalene |
| SMILES | CCCC1=Cc2cc(F)c(C#Cc3ccc(OC(F)(F)F)cc3)cc2CC1 |
| InChI | InChI=1S/C22H18F4O/c1-2-3-16-5-8-17-13-18(21(23)14-19(17)12-16)9-4-15-6-10-20(11-7-15)27-22(24,25)26/h6-7,10-14H,2-3,5,8H2,1H3 |
| InChIKey | DUZGJNOWHRBLJJ-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.38 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|