C20H14F6O — CID 22991455
4-[(E)-1,2-difluoropent-1-enyl]-2-fluoro-1-[2-[4-(trifluoromethoxy)phenyl]ethynyl]benzene (PubChem CID 22991455) has the molecular formula C20H14F6O and a molecular weight of 384.32 g/mol. Its IUPAC name is 4-[(E)-1,2-difluoropent-1-enyl]-2-fluoro-1-[2-[4-(trifluoromethoxy)phenyl]ethynyl]benzene.
| Compound Name | 4-[(E)-1,2-difluoropent-1-enyl]-2-fluoro-1-[2-[4-(trifluoromethoxy)phenyl]ethynyl]benzene |
|---|---|
| PubChem CID | 22991455 |
| Molecular Formula | C20H14F6O |
| Molecular Weight | 384.32 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | 4-[(E)-1,2-difluoropent-1-enyl]-2-fluoro-1-[2-[4-(trifluoromethoxy)phenyl]ethynyl]benzene |
| SMILES | CCC/C(F)=C(\F)c1ccc(C#Cc2ccc(OC(F)(F)F)cc2)c(F)c1 |
| InChI | InChI=1S/C20H14F6O/c1-2-3-17(21)19(23)15-9-8-14(18(22)12-15)7-4-13-5-10-16(11-6-13)27-20(24,25)26/h5-6,8-12H,2-3H2,1H3/b19-17+ |
| InChIKey | NOKNSMYFQMRWMU-HTXNQAPBSA-N |
| XLogP | 6.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.32 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|