C23H12F5NOS — CID 155260923
[2-fluoro-4-[2-[2-fluoro-4-[4-(trifluoromethoxy)phenyl]phenyl]ethynyl]-6-methylphenyl] thiocyanate (PubChem CID 155260923) has the molecular formula C23H12F5NOS and a molecular weight of 445.41 g/mol. Its IUPAC name is [2-fluoro-4-[2-[2-fluoro-4-[4-(trifluoromethoxy)phenyl]phenyl]ethynyl]-6-methylphenyl] thiocyanate.
| Compound Name | [2-fluoro-4-[2-[2-fluoro-4-[4-(trifluoromethoxy)phenyl]phenyl]ethynyl]-6-methylphenyl] thiocyanate |
|---|---|
| PubChem CID | 155260923 |
| Molecular Formula | C23H12F5NOS |
| Molecular Weight | 445.41 g/mol |
| Exact Mass | 445.06 |
| IUPAC Name | [2-fluoro-4-[2-[2-fluoro-4-[4-(trifluoromethoxy)phenyl]phenyl]ethynyl]-6-methylphenyl] thiocyanate |
| SMILES | Cc1cc(C#Cc2ccc(-c3ccc(OC(F)(F)F)cc3)cc2F)cc(F)c1SC#N |
| InChI | InChI=1S/C23H12F5NOS/c1-14-10-15(11-21(25)22(14)31-13-29)2-3-17-4-5-18(12-20(17)24)16-6-8-19(9-7-16)30-23(26,27)28/h4-12H,1H3 |
| InChIKey | UWXWAPAYYDUKSK-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.41 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|