C15H7F2NS — CID 126684326
[2,6-difluoro-4-(2-phenylethynyl)phenyl] thiocyanate (PubChem CID 126684326) has the molecular formula C15H7F2NS and a molecular weight of 271.29 g/mol. Its IUPAC name is [2,6-difluoro-4-(2-phenylethynyl)phenyl] thiocyanate.
| Compound Name | [2,6-difluoro-4-(2-phenylethynyl)phenyl] thiocyanate |
|---|---|
| PubChem CID | 126684326 |
| Molecular Formula | C15H7F2NS |
| Molecular Weight | 271.29 g/mol |
| Exact Mass | 271.03 |
| IUPAC Name | [2,6-difluoro-4-(2-phenylethynyl)phenyl] thiocyanate |
| SMILES | N#CSc1c(F)cc(C#Cc2ccccc2)cc1F |
| InChI | InChI=1S/C15H7F2NS/c16-13-8-12(9-14(17)15(13)19-10-18)7-6-11-4-2-1-3-5-11/h1-5,8-9H |
| InChIKey | YHGMFTQMKYSBJV-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.29 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|