C21H21F2NS2 — CID 145339495
[4-[2-(4-butylsulfanylphenyl)ethynyl]-2,6-difluorophenyl] thiocyanate;ethane (PubChem CID 145339495) has the molecular formula C21H21F2NS2 and a molecular weight of 389.54 g/mol. Its IUPAC name is [4-[2-(4-butylsulfanylphenyl)ethynyl]-2,6-difluorophenyl] thiocyanate;ethane.
| Compound Name | [4-[2-(4-butylsulfanylphenyl)ethynyl]-2,6-difluorophenyl] thiocyanate;ethane |
|---|---|
| PubChem CID | 145339495 |
| Molecular Formula | C21H21F2NS2 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | [4-[2-(4-butylsulfanylphenyl)ethynyl]-2,6-difluorophenyl] thiocyanate;ethane |
| SMILES | CC.CCCCSc1ccc(C#Cc2cc(F)c(SC#N)c(F)c2)cc1 |
| InChI | InChI=1S/C19H15F2NS2.C2H6/c1-2-3-10-23-16-8-6-14(7-9-16)4-5-15-11-17(20)19(24-13-22)18(21)12-15;1-2/h6-9,11-12H,2-3,10H2,1H3;1-2H3 |
| InChIKey | JXOWUVIPMVBHNJ-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|