C12H13F2NS — CID 107749305
3,5-difluoro-4-pentylsulfanylbenzonitrile (PubChem CID 107749305) has the molecular formula C12H13F2NS and a molecular weight of 241.31 g/mol. Its IUPAC name is 3,5-difluoro-4-pentylsulfanylbenzonitrile.
| Compound Name | 3,5-difluoro-4-pentylsulfanylbenzonitrile |
|---|---|
| PubChem CID | 107749305 |
| Molecular Formula | C12H13F2NS |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | 3,5-difluoro-4-pentylsulfanylbenzonitrile |
| SMILES | CCCCCSc1c(F)cc(C#N)cc1F |
| InChI | InChI=1S/C12H13F2NS/c1-2-3-4-5-16-12-10(13)6-9(8-15)7-11(12)14/h6-7H,2-5H2,1H3 |
| InChIKey | JSYOVPBIXCZSRI-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|