C10H9F2NO2S2 — CID 81283216
3,5-difluoro-4-(2-methylsulfonylethylsulfanyl)benzonitrile (PubChem CID 81283216) has the molecular formula C10H9F2NO2S2 and a molecular weight of 277.32 g/mol. Its IUPAC name is 3,5-difluoro-4-(2-methylsulfonylethylsulfanyl)benzonitrile.
| Compound Name | 3,5-difluoro-4-(2-methylsulfonylethylsulfanyl)benzonitrile |
|---|---|
| PubChem CID | 81283216 |
| Molecular Formula | C10H9F2NO2S2 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.00 |
| IUPAC Name | 3,5-difluoro-4-(2-methylsulfonylethylsulfanyl)benzonitrile |
| SMILES | CS(=O)(=O)CCSc1c(F)cc(C#N)cc1F |
| InChI | InChI=1S/C10H9F2NO2S2/c1-17(14,15)3-2-16-10-8(11)4-7(6-13)5-9(10)12/h4-5H,2-3H2,1H3 |
| InChIKey | DTFGKWGJVWEYPX-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |