C10H9F3N2O2S2 — CID 79877270
2-(2-methylsulfonylethylsulfanyl)-6-(trifluoromethyl)pyridine-3-carbonitrile (PubChem CID 79877270) has the molecular formula C10H9F3N2O2S2 and a molecular weight of 310.32 g/mol. Its IUPAC name is 2-(2-methylsulfonylethylsulfanyl)-6-(trifluoromethyl)pyridine-3-carbonitrile.
| Compound Name | 2-(2-methylsulfonylethylsulfanyl)-6-(trifluoromethyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 79877270 |
| Molecular Formula | C10H9F3N2O2S2 |
| Molecular Weight | 310.32 g/mol |
| Exact Mass | 310.01 |
| IUPAC Name | 2-(2-methylsulfonylethylsulfanyl)-6-(trifluoromethyl)pyridine-3-carbonitrile |
| SMILES | CS(=O)(=O)CCSc1nc(C(F)(F)F)ccc1C#N |
| InChI | InChI=1S/C10H9F3N2O2S2/c1-19(16,17)5-4-18-9-7(6-14)2-3-8(15-9)10(11,12)13/h2-3H,4-5H2,1H3 |
| InChIKey | WMHIYKVFBVXSJW-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 70.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.32 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |