C14H15F3N2S — CID 79877541
2-(3-methylcyclohexyl)sulfanyl-6-(trifluoromethyl)pyridine-3-carbonitrile (PubChem CID 79877541) has the molecular formula C14H15F3N2S and a molecular weight of 300.35 g/mol. Its IUPAC name is 2-(3-methylcyclohexyl)sulfanyl-6-(trifluoromethyl)pyridine-3-carbonitrile.
| Compound Name | 2-(3-methylcyclohexyl)sulfanyl-6-(trifluoromethyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 79877541 |
| Molecular Formula | C14H15F3N2S |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 2-(3-methylcyclohexyl)sulfanyl-6-(trifluoromethyl)pyridine-3-carbonitrile |
| SMILES | CC1CCCC(Sc2nc(C(F)(F)F)ccc2C#N)C1 |
| InChI | InChI=1S/C14H15F3N2S/c1-9-3-2-4-11(7-9)20-13-10(8-18)5-6-12(19-13)14(15,16)17/h5-6,9,11H,2-4,7H2,1H3 |
| InChIKey | IHIHDZIPROBYHG-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |