C11H11F3N2S — CID 78966225
2-tert-butylsulfanyl-6-(trifluoromethyl)pyridine-3-carbonitrile (PubChem CID 78966225) has the molecular formula C11H11F3N2S and a molecular weight of 260.28 g/mol. Its IUPAC name is 2-tert-butylsulfanyl-6-(trifluoromethyl)pyridine-3-carbonitrile.
| Compound Name | 2-tert-butylsulfanyl-6-(trifluoromethyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 78966225 |
| Molecular Formula | C11H11F3N2S |
| Molecular Weight | 260.28 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 2-tert-butylsulfanyl-6-(trifluoromethyl)pyridine-3-carbonitrile |
| SMILES | CC(C)(C)Sc1nc(C(F)(F)F)ccc1C#N |
| InChI | InChI=1S/C11H11F3N2S/c1-10(2,3)17-9-7(6-15)4-5-8(16-9)11(12,13)14/h4-5H,1-3H3 |
| InChIKey | OTJLBSWQIVQFHU-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.28 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |