C9H10F3N3O3S2 — CID 115824731
2-(2-sulfamoylethylsulfanyl)-6-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 115824731) has the molecular formula C9H10F3N3O3S2 and a molecular weight of 329.33 g/mol. Its IUPAC name is 2-(2-sulfamoylethylsulfanyl)-6-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | 2-(2-sulfamoylethylsulfanyl)-6-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 115824731 |
| Molecular Formula | C9H10F3N3O3S2 |
| Molecular Weight | 329.33 g/mol |
| Exact Mass | 329.01 |
| IUPAC Name | 2-(2-sulfamoylethylsulfanyl)-6-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | NC(=O)c1ccc(C(F)(F)F)nc1SCCS(N)(=O)=O |
| InChI | InChI=1S/C9H10F3N3O3S2/c10-9(11,12)6-2-1-5(7(13)16)8(15-6)19-3-4-20(14,17)18/h1-2H,3-4H2,(H2,13,16)(H2,14,17,18) |
| InChIKey | FHGOFDDZKCSUCB-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 116.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.33 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |