C11H12ClF3N2OS — CID 79876806
2-(4-chlorobutan-2-ylsulfanyl)-6-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 79876806) has the molecular formula C11H12ClF3N2OS and a molecular weight of 312.74 g/mol. Its IUPAC name is 2-(4-chlorobutan-2-ylsulfanyl)-6-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | 2-(4-chlorobutan-2-ylsulfanyl)-6-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 79876806 |
| Molecular Formula | C11H12ClF3N2OS |
| Molecular Weight | 312.74 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | 2-(4-chlorobutan-2-ylsulfanyl)-6-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | CC(CCCl)Sc1nc(C(F)(F)F)ccc1C(N)=O |
| InChI | InChI=1S/C11H12ClF3N2OS/c1-6(4-5-12)19-10-7(9(16)18)2-3-8(17-10)11(13,14)15/h2-3,6H,4-5H2,1H3,(H2,16,18) |
| InChIKey | BYGHNBKUHLSILT-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.74 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|