C11H14F3N3O — CID 79869003
2-[methyl(propan-2-yl)amino]-6-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 79869003) has the molecular formula C11H14F3N3O and a molecular weight of 261.25 g/mol. Its IUPAC name is 2-[methyl(propan-2-yl)amino]-6-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | 2-[methyl(propan-2-yl)amino]-6-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 79869003 |
| Molecular Formula | C11H14F3N3O |
| Molecular Weight | 261.25 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 2-[methyl(propan-2-yl)amino]-6-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | CC(C)N(C)c1nc(C(F)(F)F)ccc1C(N)=O |
| InChI | InChI=1S/C11H14F3N3O/c1-6(2)17(3)10-7(9(15)18)4-5-8(16-10)11(12,13)14/h4-6H,1-3H3,(H2,15,18) |
| InChIKey | MJLUSOKDEKZEEU-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.25 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |