C14H18F3N3O — CID 79875324
2-[cyclopropylmethyl(propan-2-yl)amino]-6-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 79875324) has the molecular formula C14H18F3N3O and a molecular weight of 301.31 g/mol. Its IUPAC name is 2-[cyclopropylmethyl(propan-2-yl)amino]-6-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | 2-[cyclopropylmethyl(propan-2-yl)amino]-6-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 79875324 |
| Molecular Formula | C14H18F3N3O |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 2-[cyclopropylmethyl(propan-2-yl)amino]-6-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | CC(C)N(CC1CC1)c1nc(C(F)(F)F)ccc1C(N)=O |
| InChI | InChI=1S/C14H18F3N3O/c1-8(2)20(7-9-3-4-9)13-10(12(18)21)5-6-11(19-13)14(15,16)17/h5-6,8-9H,3-4,7H2,1-2H3,(H2,18,21) |
| InChIKey | YAQSAAIIKAEHRN-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |