C12H14F3N3O2 — CID 82738993
2-[methyl(oxolan-3-yl)amino]-6-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 82738993) has the molecular formula C12H14F3N3O2 and a molecular weight of 289.26 g/mol. Its IUPAC name is 2-[methyl(oxolan-3-yl)amino]-6-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | 2-[methyl(oxolan-3-yl)amino]-6-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 82738993 |
| Molecular Formula | C12H14F3N3O2 |
| Molecular Weight | 289.26 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 2-[methyl(oxolan-3-yl)amino]-6-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | CN(c1nc(C(F)(F)F)ccc1C(N)=O)C1CCOC1 |
| InChI | InChI=1S/C12H14F3N3O2/c1-18(7-4-5-20-6-7)11-8(10(16)19)2-3-9(17-11)12(13,14)15/h2-3,7H,4-6H2,1H3,(H2,16,19) |
| InChIKey | WAJIAKJDNOZKTJ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.26 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |