C12H7ClF3N3OS — CID 79875347
2-[(5-chloro-2-pyridinyl)sulfanyl]-6-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 79875347) has the molecular formula C12H7ClF3N3OS and a molecular weight of 333.72 g/mol. Its IUPAC name is 2-[(5-chloro-2-pyridinyl)sulfanyl]-6-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | 2-[(5-chloro-2-pyridinyl)sulfanyl]-6-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 79875347 |
| Molecular Formula | C12H7ClF3N3OS |
| Molecular Weight | 333.72 g/mol |
| Exact Mass | 333.00 |
| IUPAC Name | 2-[(5-chloro-2-pyridinyl)sulfanyl]-6-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | NC(=O)c1ccc(C(F)(F)F)nc1Sc1ccc(Cl)cn1 |
| InChI | InChI=1S/C12H7ClF3N3OS/c13-6-1-4-9(18-5-6)21-11-7(10(17)20)2-3-8(19-11)12(14,15)16/h1-5H,(H2,17,20) |
| InChIKey | IVODTVUBWMEWRB-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.72 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |