C7H4BrF3N2O — CID 50878544
2-bromo-6-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 50878544) has the molecular formula C7H4BrF3N2O and a molecular weight of 269.02 g/mol. Its IUPAC name is 2-bromo-6-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | 2-bromo-6-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 50878544 |
| Molecular Formula | C7H4BrF3N2O |
| Molecular Weight | 269.02 g/mol |
| Exact Mass | 267.95 |
| IUPAC Name | 2-bromo-6-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | NC(=O)c1ccc(C(F)(F)F)nc1Br |
| InChI | InChI=1S/C7H4BrF3N2O/c8-5-3(6(12)14)1-2-4(13-5)7(9,10)11/h1-2H,(H2,12,14) |
| InChIKey | SVPQGHARQRRPFL-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.02 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|