C14H10F3NO2S — CID 67912405
2-benzylsulfanyl-6-(trifluoromethyl)pyridine-3-carboxylic acid (PubChem CID 67912405) has the molecular formula C14H10F3NO2S and a molecular weight of 313.30 g/mol. Its IUPAC name is 2-benzylsulfanyl-6-(trifluoromethyl)pyridine-3-carboxylic acid.
| Compound Name | 2-benzylsulfanyl-6-(trifluoromethyl)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 67912405 |
| Molecular Formula | C14H10F3NO2S |
| Molecular Weight | 313.30 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | 2-benzylsulfanyl-6-(trifluoromethyl)pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1ccc(C(F)(F)F)nc1SCc1ccccc1 |
| InChI | InChI=1S/C14H10F3NO2S/c15-14(16,17)11-7-6-10(13(19)20)12(18-11)21-8-9-4-2-1-3-5-9/h1-7H,8H2,(H,19,20) |
| InChIKey | CRYNWMHUFODPIJ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.30 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |