C10H14F3N3O2S2 — CID 114566632
N-ethyl-4-(2-methylsulfonylethylsulfanyl)-6-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 114566632) has the molecular formula C10H14F3N3O2S2 and a molecular weight of 329.37 g/mol. Its IUPAC name is N-ethyl-4-(2-methylsulfonylethylsulfanyl)-6-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | N-ethyl-4-(2-methylsulfonylethylsulfanyl)-6-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 114566632 |
| Molecular Formula | C10H14F3N3O2S2 |
| Molecular Weight | 329.37 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | N-ethyl-4-(2-methylsulfonylethylsulfanyl)-6-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | CCNc1nc(SCCS(C)(=O)=O)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C10H14F3N3O2S2/c1-3-14-9-15-7(10(11,12)13)6-8(16-9)19-4-5-20(2,17)18/h6H,3-5H2,1-2H3,(H,14,15,16) |
| InChIKey | ZMSCMIFIYQWDHT-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.37 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |