C11H10F3N5S — CID 114566849
N-ethyl-4-pyrimidin-4-ylsulfanyl-6-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 114566849) has the molecular formula C11H10F3N5S and a molecular weight of 301.30 g/mol. Its IUPAC name is N-ethyl-4-pyrimidin-4-ylsulfanyl-6-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | N-ethyl-4-pyrimidin-4-ylsulfanyl-6-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 114566849 |
| Molecular Formula | C11H10F3N5S |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | N-ethyl-4-pyrimidin-4-ylsulfanyl-6-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | CCNc1nc(Sc2ccncn2)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C11H10F3N5S/c1-2-16-10-18-7(11(12,13)14)5-9(19-10)20-8-3-4-15-6-17-8/h3-6H,2H2,1H3,(H,16,18,19) |
| InChIKey | DPACJFPPQWSAHS-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |