C11H10Cl2N4S — CID 102761520
3,5-dichloro-N-ethyl-6-pyrimidin-4-ylsulfanylpyridin-2-amine (PubChem CID 102761520) has the molecular formula C11H10Cl2N4S and a molecular weight of 301.20 g/mol. Its IUPAC name is 3,5-dichloro-N-ethyl-6-pyrimidin-4-ylsulfanylpyridin-2-amine.
| Compound Name | 3,5-dichloro-N-ethyl-6-pyrimidin-4-ylsulfanylpyridin-2-amine |
|---|---|
| PubChem CID | 102761520 |
| Molecular Formula | C11H10Cl2N4S |
| Molecular Weight | 301.20 g/mol |
| Exact Mass | 300.00 |
| IUPAC Name | 3,5-dichloro-N-ethyl-6-pyrimidin-4-ylsulfanylpyridin-2-amine |
| SMILES | CCNc1nc(Sc2ccncn2)c(Cl)cc1Cl |
| InChI | InChI=1S/C11H10Cl2N4S/c1-2-15-10-7(12)5-8(13)11(17-10)18-9-3-4-14-6-16-9/h3-6H,2H2,1H3,(H,15,17) |
| InChIKey | HNUWZXQAVJFAQU-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.20 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |