C11H15F2NO2S2 — CID 106728925
3,5-difluoro-4-(2-propylsulfonylethylsulfanyl)aniline (PubChem CID 106728925) has the molecular formula C11H15F2NO2S2 and a molecular weight of 295.38 g/mol. Its IUPAC name is 3,5-difluoro-4-(2-propylsulfonylethylsulfanyl)aniline.
| Compound Name | 3,5-difluoro-4-(2-propylsulfonylethylsulfanyl)aniline |
|---|---|
| PubChem CID | 106728925 |
| Molecular Formula | C11H15F2NO2S2 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | 3,5-difluoro-4-(2-propylsulfonylethylsulfanyl)aniline |
| SMILES | CCCS(=O)(=O)CCSc1c(F)cc(N)cc1F |
| InChI | InChI=1S/C11H15F2NO2S2/c1-2-4-18(15,16)5-3-17-11-9(12)6-8(14)7-10(11)13/h6-7H,2-5,14H2,1H3 |
| InChIKey | NVVQHRMOPQDSFZ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|