C10H13F2NO2S2 — CID 113474111
4-(2-ethylsulfanylethylsulfonyl)-3,5-difluoroaniline (PubChem CID 113474111) has the molecular formula C10H13F2NO2S2 and a molecular weight of 281.35 g/mol. Its IUPAC name is 4-(2-ethylsulfanylethylsulfonyl)-3,5-difluoroaniline.
| Compound Name | 4-(2-ethylsulfanylethylsulfonyl)-3,5-difluoroaniline |
|---|---|
| PubChem CID | 113474111 |
| Molecular Formula | C10H13F2NO2S2 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | 4-(2-ethylsulfanylethylsulfonyl)-3,5-difluoroaniline |
| SMILES | CCSCCS(=O)(=O)c1c(F)cc(N)cc1F |
| InChI | InChI=1S/C10H13F2NO2S2/c1-2-16-3-4-17(14,15)10-8(11)5-7(13)6-9(10)12/h5-6H,2-4,13H2,1H3 |
| InChIKey | AVZVYOKQHVKBRM-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|