C11H15F2NO2S — CID 61368233
3,5-difluoro-4-pentylsulfonylaniline (PubChem CID 61368233) has the molecular formula C11H15F2NO2S and a molecular weight of 263.31 g/mol. Its IUPAC name is 3,5-difluoro-4-pentylsulfonylaniline.
| Compound Name | 3,5-difluoro-4-pentylsulfonylaniline |
|---|---|
| PubChem CID | 61368233 |
| Molecular Formula | C11H15F2NO2S |
| Molecular Weight | 263.31 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | 3,5-difluoro-4-pentylsulfonylaniline |
| SMILES | CCCCCS(=O)(=O)c1c(F)cc(N)cc1F |
| InChI | InChI=1S/C11H15F2NO2S/c1-2-3-4-5-17(15,16)11-9(12)6-8(14)7-10(11)13/h6-7H,2-5,14H2,1H3 |
| InChIKey | XBWNGZSADYKACY-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.31 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|