C9H11F2NO3S — CID 61369182
3,5-difluoro-4-(2-methoxyethylsulfonyl)aniline (PubChem CID 61369182) has the molecular formula C9H11F2NO3S and a molecular weight of 251.25 g/mol. Its IUPAC name is 3,5-difluoro-4-(2-methoxyethylsulfonyl)aniline.
| Compound Name | 3,5-difluoro-4-(2-methoxyethylsulfonyl)aniline |
|---|---|
| PubChem CID | 61369182 |
| Molecular Formula | C9H11F2NO3S |
| Molecular Weight | 251.25 g/mol |
| Exact Mass | 251.04 |
| IUPAC Name | 3,5-difluoro-4-(2-methoxyethylsulfonyl)aniline |
| SMILES | COCCS(=O)(=O)c1c(F)cc(N)cc1F |
| InChI | InChI=1S/C9H11F2NO3S/c1-15-2-3-16(13,14)9-7(10)4-6(12)5-8(9)11/h4-5H,2-3,12H2,1H3 |
| InChIKey | ZWPOAJFUNMTZPE-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.25 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|