C12H18O6S2 — CID 121011835
1,4-bis(2-methoxyethylsulfonyl)benzene (PubChem CID 121011835) has the molecular formula C12H18O6S2 and a molecular weight of 322.40 g/mol. Its IUPAC name is 1,4-bis(2-methoxyethylsulfonyl)benzene.
| Compound Name | 1,4-bis(2-methoxyethylsulfonyl)benzene |
|---|---|
| PubChem CID | 121011835 |
| Molecular Formula | C12H18O6S2 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | 1,4-bis(2-methoxyethylsulfonyl)benzene |
| SMILES | COCCS(=O)(=O)c1ccc(S(=O)(=O)CCOC)cc1 |
| InChI | InChI=1S/C12H18O6S2/c1-17-7-9-19(13,14)11-3-5-12(6-4-11)20(15,16)10-8-18-2/h3-6H,7-10H2,1-2H3 |
| InChIKey | FWSNDGCFPHSVMF-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |