C11H15NO6S2 — CID 56800656
4-(2-methoxyethylsulfonyl)-N-methylsulfonylbenzamide (PubChem CID 56800656) has the molecular formula C11H15NO6S2 and a molecular weight of 321.38 g/mol. Its IUPAC name is 4-(2-methoxyethylsulfonyl)-N-methylsulfonylbenzamide.
| Compound Name | 4-(2-methoxyethylsulfonyl)-N-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 56800656 |
| Molecular Formula | C11H15NO6S2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.03 |
| IUPAC Name | 4-(2-methoxyethylsulfonyl)-N-methylsulfonylbenzamide |
| SMILES | COCCS(=O)(=O)c1ccc(C(=O)NS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C11H15NO6S2/c1-18-7-8-20(16,17)10-5-3-9(4-6-10)11(13)12-19(2,14)15/h3-6H,7-8H2,1-2H3,(H,12,13) |
| InChIKey | RPMAYQVRIMMSME-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |