C16H17NO6S2 — CID 122110719
5-[[[4-(2-methoxyethylsulfonyl)benzoyl]amino]methyl]thiophene-2-carboxylic acid (PubChem CID 122110719) has the molecular formula C16H17NO6S2 and a molecular weight of 383.45 g/mol. Its IUPAC name is 5-[[[4-(2-methoxyethylsulfonyl)benzoyl]amino]methyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[[[4-(2-methoxyethylsulfonyl)benzoyl]amino]methyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 122110719 |
| Molecular Formula | C16H17NO6S2 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.05 |
| IUPAC Name | 5-[[[4-(2-methoxyethylsulfonyl)benzoyl]amino]methyl]thiophene-2-carboxylic acid |
| SMILES | COCCS(=O)(=O)c1ccc(C(=O)NCc2ccc(C(=O)O)s2)cc1 |
| InChI | InChI=1S/C16H17NO6S2/c1-23-8-9-25(21,22)13-5-2-11(3-6-13)15(18)17-10-12-4-7-14(24-12)16(19)20/h2-7H,8-10H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | HIUBBXNOBAEFGA-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |