C16H17NO5S — CID 122110606
5-[[[4-(2-methoxyethoxy)benzoyl]amino]methyl]thiophene-2-carboxylic acid (PubChem CID 122110606) has the molecular formula C16H17NO5S and a molecular weight of 335.38 g/mol. Its IUPAC name is 5-[[[4-(2-methoxyethoxy)benzoyl]amino]methyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[[[4-(2-methoxyethoxy)benzoyl]amino]methyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 122110606 |
| Molecular Formula | C16H17NO5S |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | 5-[[[4-(2-methoxyethoxy)benzoyl]amino]methyl]thiophene-2-carboxylic acid |
| SMILES | COCCOc1ccc(C(=O)NCc2ccc(C(=O)O)s2)cc1 |
| InChI | InChI=1S/C16H17NO5S/c1-21-8-9-22-12-4-2-11(3-5-12)15(18)17-10-13-6-7-14(23-13)16(19)20/h2-7H,8-10H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | JDBUMCPLXKONGN-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|