C19H22N2O5S2 — CID 56577038
S-[2-[[4-(2-methoxyethylsulfonyl)benzoyl]amino]phenyl] N,N-dimethylcarbamothioate (PubChem CID 56577038) has the molecular formula C19H22N2O5S2 and a molecular weight of 422.53 g/mol. Its IUPAC name is S-[2-[[4-(2-methoxyethylsulfonyl)benzoyl]amino]phenyl] N,N-dimethylcarbamothioate.
| Compound Name | S-[2-[[4-(2-methoxyethylsulfonyl)benzoyl]amino]phenyl] N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 56577038 |
| Molecular Formula | C19H22N2O5S2 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | S-[2-[[4-(2-methoxyethylsulfonyl)benzoyl]amino]phenyl] N,N-dimethylcarbamothioate |
| SMILES | COCCS(=O)(=O)c1ccc(C(=O)Nc2ccccc2SC(=O)N(C)C)cc1 |
| InChI | InChI=1S/C19H22N2O5S2/c1-21(2)19(23)27-17-7-5-4-6-16(17)20-18(22)14-8-10-15(11-9-14)28(24,25)13-12-26-3/h4-11H,12-13H2,1-3H3,(H,20,22) |
| InChIKey | MXERFAQLYVORKG-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|