C19H17BrN4O2S — CID 56579674
S-[2-[[4-(4-bromopyrazol-1-yl)benzoyl]amino]phenyl] N,N-dimethylcarbamothioate (PubChem CID 56579674) has the molecular formula C19H17BrN4O2S and a molecular weight of 445.34 g/mol. Its IUPAC name is S-[2-[[4-(4-bromopyrazol-1-yl)benzoyl]amino]phenyl] N,N-dimethylcarbamothioate.
| Compound Name | S-[2-[[4-(4-bromopyrazol-1-yl)benzoyl]amino]phenyl] N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 56579674 |
| Molecular Formula | C19H17BrN4O2S |
| Molecular Weight | 445.34 g/mol |
| Exact Mass | 444.03 |
| IUPAC Name | S-[2-[[4-(4-bromopyrazol-1-yl)benzoyl]amino]phenyl] N,N-dimethylcarbamothioate |
| SMILES | CN(C)C(=O)Sc1ccccc1NC(=O)c1ccc(-n2cc(Br)cn2)cc1 |
| InChI | InChI=1S/C19H17BrN4O2S/c1-23(2)19(26)27-17-6-4-3-5-16(17)22-18(25)13-7-9-15(10-8-13)24-12-14(20)11-21-24/h3-12H,1-2H3,(H,22,25) |
| InChIKey | AVLQDQCHXXJVIH-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.34 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|