C20H17F3N4O2S — CID 56576626
S-[2-[[4-[3-(trifluoromethyl)pyrazol-1-yl]benzoyl]amino]phenyl] N,N-dimethylcarbamothioate (PubChem CID 56576626) has the molecular formula C20H17F3N4O2S and a molecular weight of 434.44 g/mol. Its IUPAC name is S-[2-[[4-[3-(trifluoromethyl)pyrazol-1-yl]benzoyl]amino]phenyl] N,N-dimethylcarbamothioate.
| Compound Name | S-[2-[[4-[3-(trifluoromethyl)pyrazol-1-yl]benzoyl]amino]phenyl] N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 56576626 |
| Molecular Formula | C20H17F3N4O2S |
| Molecular Weight | 434.44 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | S-[2-[[4-[3-(trifluoromethyl)pyrazol-1-yl]benzoyl]amino]phenyl] N,N-dimethylcarbamothioate |
| SMILES | CN(C)C(=O)Sc1ccccc1NC(=O)c1ccc(-n2ccc(C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C20H17F3N4O2S/c1-26(2)19(29)30-16-6-4-3-5-15(16)24-18(28)13-7-9-14(10-8-13)27-12-11-17(25-27)20(21,22)23/h3-12H,1-2H3,(H,24,28) |
| InChIKey | AGZALIWXOZZFNN-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.44 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|