C19H26ClN3O4S — CID 119439653
N-[2-(ethylaminomethyl)phenyl]-4-(2-methoxyethylsulfamoyl)benzamide;hydrochloride (PubChem CID 119439653) has the molecular formula C19H26ClN3O4S and a molecular weight of 427.95 g/mol. Its IUPAC name is N-[2-(ethylaminomethyl)phenyl]-4-(2-methoxyethylsulfamoyl)benzamide;hydrochloride.
| Compound Name | N-[2-(ethylaminomethyl)phenyl]-4-(2-methoxyethylsulfamoyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 119439653 |
| Molecular Formula | C19H26ClN3O4S |
| Molecular Weight | 427.95 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | N-[2-(ethylaminomethyl)phenyl]-4-(2-methoxyethylsulfamoyl)benzamide;hydrochloride |
| SMILES | CCNCc1ccccc1NC(=O)c1ccc(S(=O)(=O)NCCOC)cc1.Cl |
| InChI | InChI=1S/C19H25N3O4S.ClH/c1-3-20-14-16-6-4-5-7-18(16)22-19(23)15-8-10-17(11-9-15)27(24,25)21-12-13-26-2;/h4-11,20-21H,3,12-14H2,1-2H3,(H,22,23);1H |
| InChIKey | HXSVIRVSZCOWGE-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.95 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|