C18H24ClN3O4S — CID 119440173
N-[2-(ethylaminomethyl)phenyl]-4-methoxy-3-(methylsulfamoyl)benzamide;hydrochloride (PubChem CID 119440173) has the molecular formula C18H24ClN3O4S and a molecular weight of 413.93 g/mol. Its IUPAC name is N-[2-(ethylaminomethyl)phenyl]-4-methoxy-3-(methylsulfamoyl)benzamide;hydrochloride.
| Compound Name | N-[2-(ethylaminomethyl)phenyl]-4-methoxy-3-(methylsulfamoyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 119440173 |
| Molecular Formula | C18H24ClN3O4S |
| Molecular Weight | 413.93 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | N-[2-(ethylaminomethyl)phenyl]-4-methoxy-3-(methylsulfamoyl)benzamide;hydrochloride |
| SMILES | CCNCc1ccccc1NC(=O)c1ccc(OC)c(S(=O)(=O)NC)c1.Cl |
| InChI | InChI=1S/C18H23N3O4S.ClH/c1-4-20-12-14-7-5-6-8-15(14)21-18(22)13-9-10-16(25-3)17(11-13)26(23,24)19-2;/h5-11,19-20H,4,12H2,1-3H3,(H,21,22);1H |
| InChIKey | XYJGQYFZIVANTG-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.93 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |