C27H22N2O4S — CID 55934258
N-(2-benzamidophenyl)-4-(benzenesulfonylmethyl)benzamide (PubChem CID 55934258) has the molecular formula C27H22N2O4S and a molecular weight of 470.55 g/mol. Its IUPAC name is N-(2-benzamidophenyl)-4-(benzenesulfonylmethyl)benzamide.
| Compound Name | N-(2-benzamidophenyl)-4-(benzenesulfonylmethyl)benzamide |
|---|---|
| PubChem CID | 55934258 |
| Molecular Formula | C27H22N2O4S |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | N-(2-benzamidophenyl)-4-(benzenesulfonylmethyl)benzamide |
| SMILES | O=C(Nc1ccccc1NC(=O)c1ccc(CS(=O)(=O)c2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C27H22N2O4S/c30-26(21-9-3-1-4-10-21)28-24-13-7-8-14-25(24)29-27(31)22-17-15-20(16-18-22)19-34(32,33)23-11-5-2-6-12-23/h1-18H,19H2,(H,28,30)(H,29,31) |
| InChIKey | NNFFFIBROUFMDK-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |