C19H15BrN2O4S2 — CID 55788997
N'-[4-(benzenesulfonylmethyl)benzoyl]-5-bromothiophene-2-carbohydrazide (PubChem CID 55788997) has the molecular formula C19H15BrN2O4S2 and a molecular weight of 479.38 g/mol. Its IUPAC name is N'-[4-(benzenesulfonylmethyl)benzoyl]-5-bromothiophene-2-carbohydrazide.
| Compound Name | N'-[4-(benzenesulfonylmethyl)benzoyl]-5-bromothiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 55788997 |
| Molecular Formula | C19H15BrN2O4S2 |
| Molecular Weight | 479.38 g/mol |
| Exact Mass | 477.97 |
| IUPAC Name | N'-[4-(benzenesulfonylmethyl)benzoyl]-5-bromothiophene-2-carbohydrazide |
| SMILES | O=C(NNC(=O)c1ccc(Br)s1)c1ccc(CS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H15BrN2O4S2/c20-17-11-10-16(27-17)19(24)22-21-18(23)14-8-6-13(7-9-14)12-28(25,26)15-4-2-1-3-5-15/h1-11H,12H2,(H,21,23)(H,22,24) |
| InChIKey | UVGNCGUZLOGJQU-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.38 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|