C12H7BrF2N2O2S — CID 30497119
5-bromo-N'-(3,4-difluorobenzoyl)thiophene-2-carbohydrazide (PubChem CID 30497119) has the molecular formula C12H7BrF2N2O2S and a molecular weight of 361.17 g/mol. Its IUPAC name is 5-bromo-N'-(3,4-difluorobenzoyl)thiophene-2-carbohydrazide.
| Compound Name | 5-bromo-N'-(3,4-difluorobenzoyl)thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 30497119 |
| Molecular Formula | C12H7BrF2N2O2S |
| Molecular Weight | 361.17 g/mol |
| Exact Mass | 359.94 |
| IUPAC Name | 5-bromo-N'-(3,4-difluorobenzoyl)thiophene-2-carbohydrazide |
| SMILES | O=C(NNC(=O)c1ccc(Br)s1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C12H7BrF2N2O2S/c13-10-4-3-9(20-10)12(19)17-16-11(18)6-1-2-7(14)8(15)5-6/h1-5H,(H,16,18)(H,17,19) |
| InChIKey | PVRNRWFVUBNLGW-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.17 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|