About 5-bromo-N'-(4-methoxy-3-nitrobenzoyl)thiophene-2-carbohydrazide
5-bromo-N'-(4-methoxy-3-nitrobenzoyl)thiophene-2-carbohydrazide (PubChem CID 31728771) has the molecular formula C13H10BrN3O5S
and a molecular weight of 400.21 g/mol. Its IUPAC name is 5-bromo-N'-(4-methoxy-3-nitrobenzoyl)thiophene-2-carbohydrazide.
Molecular Properties
| Compound Name | 5-bromo-N'-(4-methoxy-3-nitrobenzoyl)thiophene-2-carbohydrazide |
| PubChem CID | 31728771 |
| Molecular Formula | C13H10BrN3O5S |
| Molecular Weight | 400.21 g/mol |
| Exact Mass | 398.95 |
| IUPAC Name | 5-bromo-N'-(4-methoxy-3-nitrobenzoyl)thiophene-2-carbohydrazide |
| SMILES | COc1ccc(C(=O)NNC(=O)c2ccc(Br)s2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H10BrN3O5S/c1-22-9-3-2-7(6-8(9)17(20)21)12(18)15-16-13(19)10-4-5-11(14)23-10/h2-6H,1H3,(H,15,18)(H,16,19) |
| InChIKey | GEZDCOKRQCCMGT-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.21 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-N'-(4-methoxy-3-nitrobenzoyl)thiophene-2-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N'-(4-methoxy-3-nitrobenzoyl)thiophene-2-carbohydrazide?
The IUPAC name of 5-bromo-N'-(4-methoxy-3-nitrobenzoyl)thiophene-2-carbohydrazide (CID 31728771) is 5-bromo-N'-(4-methoxy-3-nitrobenzoyl)thiophene-2-carbohydrazide.
What is the SMILES notation for 5-bromo-N'-(4-methoxy-3-nitrobenzoyl)thiophene-2-carbohydrazide?
The canonical SMILES for 5-bromo-N'-(4-methoxy-3-nitrobenzoyl)thiophene-2-carbohydrazide is COc1ccc(C(=O)NNC(=O)c2ccc(Br)s2)cc1[N+](=O)[O-].
What is the InChIKey of 5-bromo-N'-(4-methoxy-3-nitrobenzoyl)thiophene-2-carbohydrazide?
The InChIKey is GEZDCOKRQCCMGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10BrN3O5S/c1-22-9-3-2-7(6-8(9)17(20)21)12(18)15-16-13(19)10-4-5-11(14)23-10/h2-6H,1H3,(H,15,18)(H,16,19).
What are the key properties of 5-bromo-N'-(4-methoxy-3-nitrobenzoyl)thiophene-2-carbohydrazide?
5-bromo-N'-(4-methoxy-3-nitrobenzoyl)thiophene-2-carbohydrazide has a molecular weight of 400.21 g/mol, XLogP of 2.50, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N'-(4-methoxy-3-nitrobenzoyl)thiophene-2-carbohydrazide is sourced from PubChem (CID 31728771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).