C13H11BrN2O4S — CID 60794569
N-[(4-bromothiophen-2-yl)methyl]-4-methoxy-3-nitrobenzamide (PubChem CID 60794569) has the molecular formula C13H11BrN2O4S and a molecular weight of 371.21 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-4-methoxy-3-nitrobenzamide.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-4-methoxy-3-nitrobenzamide |
|---|---|
| PubChem CID | 60794569 |
| Molecular Formula | C13H11BrN2O4S |
| Molecular Weight | 371.21 g/mol |
| Exact Mass | 369.96 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-4-methoxy-3-nitrobenzamide |
| SMILES | COc1ccc(C(=O)NCc2cc(Br)cs2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H11BrN2O4S/c1-20-12-3-2-8(4-11(12)16(18)19)13(17)15-6-10-5-9(14)7-21-10/h2-5,7H,6H2,1H3,(H,15,17) |
| InChIKey | DAXZTDRVBXAPSE-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.21 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|