C11H13F2N3O4 — CID 114383455
N-(3-amino-2,2-difluoropropyl)-4-methoxy-3-nitrobenzamide (PubChem CID 114383455) has the molecular formula C11H13F2N3O4 and a molecular weight of 289.24 g/mol. Its IUPAC name is N-(3-amino-2,2-difluoropropyl)-4-methoxy-3-nitrobenzamide.
| Compound Name | N-(3-amino-2,2-difluoropropyl)-4-methoxy-3-nitrobenzamide |
|---|---|
| PubChem CID | 114383455 |
| Molecular Formula | C11H13F2N3O4 |
| Molecular Weight | 289.24 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | N-(3-amino-2,2-difluoropropyl)-4-methoxy-3-nitrobenzamide |
| SMILES | COc1ccc(C(=O)NCC(F)(F)CN)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H13F2N3O4/c1-20-9-3-2-7(4-8(9)16(18)19)10(17)15-6-11(12,13)5-14/h2-4H,5-6,14H2,1H3,(H,15,17) |
| InChIKey | FKHLHIRSFUZFHX-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.24 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|