C11H14F2N2O3 — CID 114383634
N-(3-amino-2,2-difluoropropyl)-3-hydroxy-4-methoxybenzamide (PubChem CID 114383634) has the molecular formula C11H14F2N2O3 and a molecular weight of 260.24 g/mol. Its IUPAC name is N-(3-amino-2,2-difluoropropyl)-3-hydroxy-4-methoxybenzamide.
| Compound Name | N-(3-amino-2,2-difluoropropyl)-3-hydroxy-4-methoxybenzamide |
|---|---|
| PubChem CID | 114383634 |
| Molecular Formula | C11H14F2N2O3 |
| Molecular Weight | 260.24 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | N-(3-amino-2,2-difluoropropyl)-3-hydroxy-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NCC(F)(F)CN)cc1O |
| InChI | InChI=1S/C11H14F2N2O3/c1-18-9-3-2-7(4-8(9)16)10(17)15-6-11(12,13)5-14/h2-4,16H,5-6,14H2,1H3,(H,15,17) |
| InChIKey | KSNNWRBNVXTKBN-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.24 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |