C13H18F2N2O4 — CID 114383408
N-(3-amino-2,2-difluoropropyl)-3,4,5-trimethoxybenzamide (PubChem CID 114383408) has the molecular formula C13H18F2N2O4 and a molecular weight of 304.29 g/mol. Its IUPAC name is N-(3-amino-2,2-difluoropropyl)-3,4,5-trimethoxybenzamide.
| Compound Name | N-(3-amino-2,2-difluoropropyl)-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 114383408 |
| Molecular Formula | C13H18F2N2O4 |
| Molecular Weight | 304.29 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | N-(3-amino-2,2-difluoropropyl)-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NCC(F)(F)CN)cc(OC)c1OC |
| InChI | InChI=1S/C13H18F2N2O4/c1-19-9-4-8(5-10(20-2)11(9)21-3)12(18)17-7-13(14,15)6-16/h4-5H,6-7,16H2,1-3H3,(H,17,18) |
| InChIKey | JQZFPXKEJBZJMK-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.29 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |