C18H25NO7 — CID 40589265
(3,3-dimethyl-2-oxobutyl) 2-[(3,4,5-trimethoxybenzoyl)amino]acetate (PubChem CID 40589265) has the molecular formula C18H25NO7 and a molecular weight of 367.40 g/mol. Its IUPAC name is (3,3-dimethyl-2-oxobutyl) 2-[(3,4,5-trimethoxybenzoyl)amino]acetate.
| Compound Name | (3,3-dimethyl-2-oxobutyl) 2-[(3,4,5-trimethoxybenzoyl)amino]acetate |
|---|---|
| PubChem CID | 40589265 |
| Molecular Formula | C18H25NO7 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | (3,3-dimethyl-2-oxobutyl) 2-[(3,4,5-trimethoxybenzoyl)amino]acetate |
| SMILES | COc1cc(C(=O)NCC(=O)OCC(=O)C(C)(C)C)cc(OC)c1OC |
| InChI | InChI=1S/C18H25NO7/c1-18(2,3)14(20)10-26-15(21)9-19-17(22)11-7-12(23-4)16(25-6)13(8-11)24-5/h7-8H,9-10H2,1-6H3,(H,19,22) |
| InChIKey | NVNALLSSZOSIBZ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |