C17H25NO7 — CID 55356834
2-propan-2-yloxyethyl 2-[(3,4,5-trimethoxybenzoyl)amino]acetate (PubChem CID 55356834) has the molecular formula C17H25NO7 and a molecular weight of 355.39 g/mol. Its IUPAC name is 2-propan-2-yloxyethyl 2-[(3,4,5-trimethoxybenzoyl)amino]acetate.
| Compound Name | 2-propan-2-yloxyethyl 2-[(3,4,5-trimethoxybenzoyl)amino]acetate |
|---|---|
| PubChem CID | 55356834 |
| Molecular Formula | C17H25NO7 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | 2-propan-2-yloxyethyl 2-[(3,4,5-trimethoxybenzoyl)amino]acetate |
| SMILES | COc1cc(C(=O)NCC(=O)OCCOC(C)C)cc(OC)c1OC |
| InChI | InChI=1S/C17H25NO7/c1-11(2)24-6-7-25-15(19)10-18-17(20)12-8-13(21-3)16(23-5)14(9-12)22-4/h8-9,11H,6-7,10H2,1-5H3,(H,18,20) |
| InChIKey | ZAZVEBIXYQBWIA-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|